C28H19BrF2O2 — CID 139083569
(E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(2-bromophenyl)prop-2-en-1-one (PubChem CID 139083569) has the molecular formula C28H19BrF2O2 and a molecular weight of 505.36 g/mol. Its IUPAC name is (E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(2-bromophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(2-bromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139083569 |
| Molecular Formula | C28H19BrF2O2 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | (E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(2-bromophenyl)prop-2-en-1-one |
| SMILES | COc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1C(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C28H19BrF2O2/c1-33-27-17-21(18-6-11-22(30)12-7-18)16-24(19-8-13-23(31)14-9-19)28(27)26(32)15-10-20-4-2-3-5-25(20)29/h2-17H,1H3/b15-10+ |
| InChIKey | YTRUEGKPMVWBPZ-XNTDXEJSSA-N |
| XLogP | 7.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|