C29H21BrF2O3 — CID 123160910
1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(3-bromo-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 123160910) has the molecular formula C29H21BrF2O3 and a molecular weight of 535.38 g/mol. Its IUPAC name is 1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(3-bromo-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(3-bromo-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123160910 |
| Molecular Formula | C29H21BrF2O3 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(3-bromo-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2c(OC)cc(-c3ccc(F)cc3)cc2-c2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C29H21BrF2O3/c1-34-27-14-4-18(15-25(27)30)3-13-26(33)29-24(20-7-11-23(32)12-8-20)16-21(17-28(29)35-2)19-5-9-22(31)10-6-19/h3-17H,1-2H3 |
| InChIKey | OQWCQTJRBXLUPD-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|