C17H16BrNO4S — CID 76878528
N-[4-[3-(3-bromo-4-methoxyphenyl)prop-2-enoyl]phenyl]methanesulfonamide (PubChem CID 76878528) has the molecular formula C17H16BrNO4S and a molecular weight of 410.29 g/mol. Its IUPAC name is N-[4-[3-(3-bromo-4-methoxyphenyl)prop-2-enoyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-(3-bromo-4-methoxyphenyl)prop-2-enoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 76878528 |
| Molecular Formula | C17H16BrNO4S |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | N-[4-[3-(3-bromo-4-methoxyphenyl)prop-2-enoyl]phenyl]methanesulfonamide |
| SMILES | COc1ccc(C=CC(=O)c2ccc(NS(C)(=O)=O)cc2)cc1Br |
| InChI | InChI=1S/C17H16BrNO4S/c1-23-17-10-4-12(11-15(17)18)3-9-16(20)13-5-7-14(8-6-13)19-24(2,21)22/h3-11,19H,1-2H3 |
| InChIKey | LCZVJZVXLNPQAL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|