C16H13BrFNO2 — CID 1183429
(E)-3-(3-bromo-4-methoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 1183429) has the molecular formula C16H13BrFNO2 and a molecular weight of 350.19 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-methoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4-methoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1183429 |
| Molecular Formula | C16H13BrFNO2 |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (E)-3-(3-bromo-4-methoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C16H13BrFNO2/c1-21-15-8-2-11(10-14(15)17)3-9-16(20)19-13-6-4-12(18)5-7-13/h2-10H,1H3,(H,19,20)/b9-3+ |
| InChIKey | HJFGAPIHOOTXJP-YCRREMRBSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|