C23H18BrF2NO3 — CID 53267420
(E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 53267420) has the molecular formula C23H18BrF2NO3 and a molecular weight of 474.30 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267420 |
| Molecular Formula | C23H18BrF2NO3 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(F)cc2)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C23H18BrF2NO3/c1-29-21-13-15(6-11-22(28)27-18-9-7-17(25)8-10-18)12-19(24)23(21)30-14-16-4-2-3-5-20(16)26/h2-13H,14H2,1H3,(H,27,28)/b11-6+ |
| InChIKey | IQISXTVLYFNJNC-IZZDOVSWSA-N |
| XLogP | 5.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|