C18H15BrClFO4 — CID 91685221
methyl (E)-3-[3-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoate (PubChem CID 91685221) has the molecular formula C18H15BrClFO4 and a molecular weight of 429.67 g/mol. Its IUPAC name is methyl (E)-3-[3-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91685221 |
| Molecular Formula | C18H15BrClFO4 |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | methyl (E)-3-[3-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(Br)c(OCc2ccc(F)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H15BrClFO4/c1-23-16-8-11(3-6-17(22)24-2)7-14(19)18(16)25-10-12-4-5-13(21)9-15(12)20/h3-9H,10H2,1-2H3/b6-3+ |
| InChIKey | ZAQICBINNZAVHA-ZZXKWVIFSA-N |
| XLogP | 5.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|