C17H15BrCl2N2O3 — CID 91685179
(E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enehydrazide (PubChem CID 91685179) has the molecular formula C17H15BrCl2N2O3 and a molecular weight of 446.13 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enehydrazide.
| Compound Name | (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 91685179 |
| Molecular Formula | C17H15BrCl2N2O3 |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enehydrazide |
| SMILES | COc1cc(/C=C/C(=O)NN)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15BrCl2N2O3/c1-24-15-7-10(2-5-16(23)22-21)6-13(18)17(15)25-9-11-3-4-12(19)8-14(11)20/h2-8H,9,21H2,1H3,(H,22,23)/b5-2+ |
| InChIKey | RXYNFKXVBRYTTE-GORDUTHDSA-N |
| XLogP | 4.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|