C24H20BrNO5 — CID 3368455
N-(1,3-benzodioxol-5-yl)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 3368455) has the molecular formula C24H20BrNO5 and a molecular weight of 482.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3368455 |
| Molecular Formula | C24H20BrNO5 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc3c(c2)OCO3)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H20BrNO5/c1-28-22-12-17(11-19(25)24(22)29-14-16-5-3-2-4-6-16)7-10-23(27)26-18-8-9-20-21(13-18)31-15-30-20/h2-13H,14-15H2,1H3,(H,26,27) |
| InChIKey | PLZPWLORVYQHNT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|