C22H18BrNO5 — CID 2471016
N-(1,3-benzodioxol-5-yl)-3-bromo-5-methoxy-4-phenylmethoxybenzamide (PubChem CID 2471016) has the molecular formula C22H18BrNO5 and a molecular weight of 456.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-bromo-5-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-bromo-5-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 2471016 |
| Molecular Formula | C22H18BrNO5 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-bromo-5-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc3c(c2)OCO3)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H18BrNO5/c1-26-20-10-15(9-17(23)21(20)27-12-14-5-3-2-4-6-14)22(25)24-16-7-8-18-19(11-16)29-13-28-18/h2-11H,12-13H2,1H3,(H,24,25) |
| InChIKey | CCRYRCQMNSEESQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |