C22H19FO5 — CID 55353370
(E)-3-[5-(4-fluorophenyl)furan-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 55353370) has the molecular formula C22H19FO5 and a molecular weight of 382.39 g/mol. Its IUPAC name is (E)-3-[5-(4-fluorophenyl)furan-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(4-fluorophenyl)furan-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55353370 |
| Molecular Formula | C22H19FO5 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (E)-3-[5-(4-fluorophenyl)furan-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccc(-c3ccc(F)cc3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H19FO5/c1-25-20-12-15(13-21(26-2)22(20)27-3)18(24)10-8-17-9-11-19(28-17)14-4-6-16(23)7-5-14/h4-13H,1-3H3/b10-8+ |
| InChIKey | ABZGGCNIBYIRKA-CSKARUKUSA-N |
| XLogP | 5.01 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|