C18H18O7 — CID 47083650
methyl 5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]furan-2-carboxylate (PubChem CID 47083650) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is methyl 5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 47083650 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methyl 5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)c2cc(OC)c(OC)c(OC)c2)o1 |
| InChI | InChI=1S/C18H18O7/c1-21-15-9-11(10-16(22-2)17(15)23-3)13(19)7-5-12-6-8-14(25-12)18(20)24-4/h5-10H,1-4H3/b7-5+ |
| InChIKey | FCXNYDWPVTUETB-FNORWQNLSA-N |
| XLogP | 2.99 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|