C26H23NO3 — CID 15485314
4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoyl]benzoic acid (PubChem CID 15485314) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoyl]benzoic acid.
| Compound Name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 15485314 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoyl]benzoic acid |
| SMILES | CC1(C)CC=C(c2ccccc2)c2cc(NC(=O)c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C26H23NO3/c1-26(2)15-14-21(17-6-4-3-5-7-17)22-16-20(12-13-23(22)26)27-24(28)18-8-10-19(11-9-18)25(29)30/h3-14,16H,15H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | AGMRCLOVOPVYJL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |