C21H23NO2 — CID 69196527
4-[[(5,5,8-trimethyl-6H-naphthalen-2-yl)amino]methyl]benzoic acid (PubChem CID 69196527) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[[(5,5,8-trimethyl-6H-naphthalen-2-yl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(5,5,8-trimethyl-6H-naphthalen-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 69196527 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[[(5,5,8-trimethyl-6H-naphthalen-2-yl)amino]methyl]benzoic acid |
| SMILES | CC1=CCC(C)(C)c2ccc(NCc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C21H23NO2/c1-14-10-11-21(2,3)19-9-8-17(12-18(14)19)22-13-15-4-6-16(7-5-15)20(23)24/h4-10,12,22H,11,13H2,1-3H3,(H,23,24) |
| InChIKey | BNUGLEVZRAGKGX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |