C28H32O2 — CID 90996188
4-[2-[8-(3,3-dimethylpent-1-enyl)-5,5-dimethyl-6H-naphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 90996188) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is 4-[2-[8-(3,3-dimethylpent-1-enyl)-5,5-dimethyl-6H-naphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[8-(3,3-dimethylpent-1-enyl)-5,5-dimethyl-6H-naphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 90996188 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 4-[2-[8-(3,3-dimethylpent-1-enyl)-5,5-dimethyl-6H-naphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CCC(C)(C)C=CC1=CCC(C)(C)c2ccc(C=Cc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C28H32O2/c1-6-27(2,3)17-15-22-16-18-28(4,5)25-14-11-21(19-24(22)25)8-7-20-9-12-23(13-10-20)26(29)30/h7-17,19H,6,18H2,1-5H3,(H,29,30) |
| InChIKey | WHWHLVFHWWPZGE-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|