C23H24N2O4 — CID 22571511
4-[[8-(2-ethoxy-2-oxoethyl)-5,5-dimethyl-6H-naphthalen-2-yl]diazenyl]benzoic acid (PubChem CID 22571511) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[[8-(2-ethoxy-2-oxoethyl)-5,5-dimethyl-6H-naphthalen-2-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[8-(2-ethoxy-2-oxoethyl)-5,5-dimethyl-6H-naphthalen-2-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 22571511 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[[8-(2-ethoxy-2-oxoethyl)-5,5-dimethyl-6H-naphthalen-2-yl]diazenyl]benzoic acid |
| SMILES | CCOC(=O)CC1=CCC(C)(C)c2ccc(/N=N/c3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C23H24N2O4/c1-4-29-21(26)13-16-11-12-23(2,3)20-10-9-18(14-19(16)20)25-24-17-7-5-15(6-8-17)22(27)28/h5-11,14H,4,12-13H2,1-3H3,(H,27,28)/b25-24+ |
| InChIKey | XIFZGEUPEHFJIG-OCOZRVBESA-N |
| XLogP | 5.82 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|