C17H22O2 — CID 22571551
8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid (PubChem CID 22571551) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid.
| Compound Name | 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 22571551 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid |
| SMILES | CC(C)(C)C1=CCC(C)(C)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C17H22O2/c1-16(2,3)13-8-9-17(4,5)14-7-6-11(15(18)19)10-12(13)14/h6-8,10H,9H2,1-5H3,(H,18,19) |
| InChIKey | MFKDOVUMGRCDFF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |