8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid

C17H22O2 — CID 22571551

IUPAC8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid
SMILESCC(C)(C)C1=CCC(C)(C)c2ccc(C(=O)O)cc21
InChIInChI=1S/C17H22O2/c1-16(2,3)13-8-9-17(4,5)14-7-6-11(15(18)19)10-12(13)14/h6-8,10H,9H2,1-5H3,(H,18,19)
InChIKeyMFKDOVUMGRCDFF-UHFFFAOYSA-N
MW258.36 g/mol
LogP4.50
Rot. Bonds1

About 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid

8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid (PubChem CID 22571551) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid
PubChem CID22571551
Molecular FormulaC17H22O2
Molecular Weight258.36 g/mol
Exact Mass258.16
IUPAC Name8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid
SMILESCC(C)(C)C1=CCC(C)(C)c2ccc(C(=O)O)cc21
InChIInChI=1S/C17H22O2/c1-16(2,3)13-8-9-17(4,5)14-7-6-11(15(18)19)10-12(13)14/h6-8,10H,9H2,1-5H3,(H,18,19)
InChIKeyMFKDOVUMGRCDFF-UHFFFAOYSA-N
XLogP4.50
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 54.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid?
The IUPAC name of 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid (CID 22571551) is 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid.
What is the SMILES notation for 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid?
The canonical SMILES for 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid is CC(C)(C)C1=CCC(C)(C)c2ccc(C(=O)O)cc21.
What is the InChIKey of 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid?
The InChIKey is MFKDOVUMGRCDFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O2/c1-16(2,3)13-8-9-17(4,5)14-7-6-11(15(18)19)10-12(13)14/h6-8,10H,9H2,1-5H3,(H,18,19).
What are the key properties of 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid?
8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid has a molecular weight of 258.36 g/mol, XLogP of 4.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-5,5-dimethyl-6H-naphthalene-2-carboxylic acid is sourced from PubChem (CID 22571551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).