About 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid
6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid (PubChem CID 10177699) has the molecular formula C24H30N2O2
and a molecular weight of 378.52 g/mol. Its IUPAC name is 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid |
| PubChem CID | 10177699 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid |
| SMILES | CCN(c1ccc2c(c1)C(C(C)(C)C)=CCC2(C)C)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C24H30N2O2/c1-7-26(21-11-8-16(15-25-21)22(27)28)17-9-10-20-18(14-17)19(23(2,3)4)12-13-24(20,5)6/h8-12,14-15H,7,13H2,1-6H3,(H,27,28) |
| InChIKey | YXTCBQDUTPIAPT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid (CID 10177699) is 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid is CCN(c1ccc2c(c1)C(C(C)(C)C)=CCC2(C)C)c1ccc(C(=O)O)cn1.
What is the InChIKey of 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid?
The InChIKey is YXTCBQDUTPIAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O2/c1-7-26(21-11-8-16(15-25-21)22(27)28)17-9-10-20-18(14-17)19(23(2,3)4)12-13-24(20,5)6/h8-12,14-15H,7,13H2,1-6H3,(H,27,28).
What are the key properties of 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid?
6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid has a molecular weight of 378.52 g/mol, XLogP of 6.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(8-tert-butyl-5,5-dimethyl-6H-naphthalen-2-yl)-ethylamino]pyridine-3-carboxylic acid is sourced from PubChem (CID 10177699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).