C30H41NO3 — CID 67551508
4-[ethyl-(3-hexoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)amino]benzoic acid (PubChem CID 67551508) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is 4-[ethyl-(3-hexoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)amino]benzoic acid.
| Compound Name | 4-[ethyl-(3-hexoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 67551508 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 4-[ethyl-(3-hexoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)amino]benzoic acid |
| SMILES | CCCCCCOc1cc2c(cc1N(CC)c1ccc(C(=O)O)cc1)C(C(C)C)=CCC2(C)C |
| InChI | InChI=1S/C30H41NO3/c1-7-9-10-11-18-34-28-20-26-25(24(21(3)4)16-17-30(26,5)6)19-27(28)31(8-2)23-14-12-22(13-15-23)29(32)33/h12-16,19-21H,7-11,17-18H2,1-6H3,(H,32,33) |
| InChIKey | CKRSUGZWHFBXPS-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|