C21H31BrO — CID 22218311
6-bromo-7-hexoxy-1,1-dimethyl-4-propan-2-yl-2H-naphthalene (PubChem CID 22218311) has the molecular formula C21H31BrO and a molecular weight of 379.38 g/mol. Its IUPAC name is 6-bromo-7-hexoxy-1,1-dimethyl-4-propan-2-yl-2H-naphthalene.
| Compound Name | 6-bromo-7-hexoxy-1,1-dimethyl-4-propan-2-yl-2H-naphthalene |
|---|---|
| PubChem CID | 22218311 |
| Molecular Formula | C21H31BrO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-bromo-7-hexoxy-1,1-dimethyl-4-propan-2-yl-2H-naphthalene |
| SMILES | CCCCCCOc1cc2c(cc1Br)C(C(C)C)=CCC2(C)C |
| InChI | InChI=1S/C21H31BrO/c1-6-7-8-9-12-23-20-14-18-17(13-19(20)22)16(15(2)3)10-11-21(18,4)5/h10,13-15H,6-9,11-12H2,1-5H3 |
| InChIKey | YWOHJAWGHDFKSD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|