C23H31FO3 — CID 86597841
ethyl (E)-3-(3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate (PubChem CID 86597841) has the molecular formula C23H31FO3 and a molecular weight of 374.50 g/mol. Its IUPAC name is ethyl (E)-3-(3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate.
| Compound Name | ethyl (E)-3-(3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate |
|---|---|
| PubChem CID | 86597841 |
| Molecular Formula | C23H31FO3 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | ethyl (E)-3-(3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(/C)c1cc2c(cc1OCC)C(C)(C)CC=C2C(C)C |
| InChI | InChI=1S/C23H31FO3/c1-8-26-20-13-19-18(16(14(3)4)10-11-23(19,6)7)12-17(20)15(5)21(24)22(25)27-9-2/h10,12-14H,8-9,11H2,1-7H3/b21-15+ |
| InChIKey | QCPUSAJFYGXPNP-RCCKNPSSSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|