C24H33FO3 — CID 90686338
ethyl 3-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate (PubChem CID 90686338) has the molecular formula C24H33FO3 and a molecular weight of 388.52 g/mol. Its IUPAC name is ethyl 3-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate.
| Compound Name | ethyl 3-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate |
|---|---|
| PubChem CID | 90686338 |
| Molecular Formula | C24H33FO3 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | ethyl 3-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-2-fluorobut-2-enoate |
| SMILES | CCOC(=O)C(F)=C(C)c1cc2c(cc1OCC)C(C)(C)CC=C2C(C)(C)C |
| InChI | InChI=1S/C24H33FO3/c1-9-27-20-14-19-17(18(23(4,5)6)11-12-24(19,7)8)13-16(20)15(3)21(25)22(26)28-10-2/h11,13-14H,9-10,12H2,1-8H3 |
| InChIKey | ZBUMUQJXUIXOLL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|