C26H34F2O3 — CID 85045969
7-(3-ethoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoic acid (PubChem CID 85045969) has the molecular formula C26H34F2O3 and a molecular weight of 432.55 g/mol. Its IUPAC name is 7-(3-ethoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoic acid.
| Compound Name | 7-(3-ethoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 85045969 |
| Molecular Formula | C26H34F2O3 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 7-(3-ethoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoic acid |
| SMILES | CCOc1cc2c(cc1C(CC)=C(F)C=CC(C)=C(F)C(=O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H34F2O3/c1-8-17(21(27)11-10-16(3)23(28)24(29)30)18-14-19-20(15-22(18)31-9-2)26(6,7)13-12-25(19,4)5/h10-11,14-15H,8-9,12-13H2,1-7H3,(H,29,30) |
| InChIKey | VRUDXAYZASOLFZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|