C28H38O3 — CID 57076071
5-(cyclopenten-1-yl)-3-methyl-2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)penta-2,4-dienoic acid (PubChem CID 57076071) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is 5-(cyclopenten-1-yl)-3-methyl-2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)penta-2,4-dienoic acid.
| Compound Name | 5-(cyclopenten-1-yl)-3-methyl-2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 57076071 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 5-(cyclopenten-1-yl)-3-methyl-2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)penta-2,4-dienoic acid |
| SMILES | CCCOc1cc2c(cc1C(C(=O)O)=C(C)C=CC1=CCCC1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H38O3/c1-7-16-31-24-18-23-22(27(3,4)14-15-28(23,5)6)17-21(24)25(26(29)30)19(2)12-13-20-10-8-9-11-20/h10,12-13,17-18H,7-9,11,14-16H2,1-6H3,(H,29,30) |
| InChIKey | XVMSJWFDCQZFNS-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|