C30H40O3 — CID 54251310
3-[3-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]prop-2-enoic acid (PubChem CID 54251310) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is 3-[3-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54251310 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 3-[3-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]prop-2-enoic acid |
| SMILES | CCCCCCCOc1cc2c(cc1-c1cccc(C=CC(=O)O)c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H40O3/c1-6-7-8-9-10-18-33-27-21-26-25(29(2,3)16-17-30(26,4)5)20-24(27)23-13-11-12-22(19-23)14-15-28(31)32/h11-15,19-21H,6-10,16-18H2,1-5H3,(H,31,32) |
| InChIKey | QWYLCJZESFQTMT-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|