C36H50O6 — CID 22345430
(E)-3-[4-methoxy-3-[5,5,8,8-tetramethyl-3-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 22345430) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[5,5,8,8-tetramethyl-3-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methoxy-3-[5,5,8,8-tetramethyl-3-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22345430 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | (E)-3-[4-methoxy-3-[5,5,8,8-tetramethyl-3-[8-[(2-methylpropan-2-yl)oxy]-8-oxooctoxy]-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1-c1cc2c(cc1OCCCCCCCC(=O)OC(C)(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C36H50O6/c1-34(2,3)42-33(39)14-12-10-9-11-13-21-41-31-24-29-28(35(4,5)19-20-36(29,6)7)23-27(31)26-22-25(16-18-32(37)38)15-17-30(26)40-8/h15-18,22-24H,9-14,19-21H2,1-8H3,(H,37,38)/b18-16+ |
| InChIKey | COLUBWDKWAQUPQ-FBMGVBCBSA-N |
| XLogP | 8.87 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|