C28H40O3 — CID 23205967
(3E,5E,7E)-4-methyl-8-(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoic acid (PubChem CID 23205967) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is (3E,5E,7E)-4-methyl-8-(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoic acid.
| Compound Name | (3E,5E,7E)-4-methyl-8-(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 23205967 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (3E,5E,7E)-4-methyl-8-(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoic acid |
| SMILES | CCCCCOc1cc2c(cc1/C=C/C=C/C(C)=C/CC(=O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H40O3/c1-7-8-11-18-31-25-20-24-23(27(3,4)16-17-28(24,5)6)19-22(25)13-10-9-12-21(2)14-15-26(29)30/h9-10,12-14,19-20H,7-8,11,15-18H2,1-6H3,(H,29,30)/b12-9+,13-10+,21-14+ |
| InChIKey | MXWUMUAYPCYPJB-HWJKAKEJSA-N |
| XLogP | 7.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|