C28H34O3Se — CID 101046276
3-[2-[(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoic acid (PubChem CID 101046276) has the molecular formula C28H34O3Se and a molecular weight of 497.54 g/mol. Its IUPAC name is 3-[2-[(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoic acid.
| Compound Name | 3-[2-[(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 101046276 |
| Molecular Formula | C28H34O3Se |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-[2-[(5,5,8,8-tetramethyl-3-pentoxy-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoic acid |
| SMILES | CCCCCOc1cc2c(cc1[Se]C#Cc1cccc(C(=O)O)c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H34O3Se/c1-6-7-8-15-31-24-18-22-23(28(4,5)14-13-27(22,2)3)19-25(24)32-16-12-20-10-9-11-21(17-20)26(29)30/h9-11,17-19H,6-8,13-15H2,1-5H3,(H,29,30) |
| InChIKey | WVLLQZIDHMUHOQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|