C28H40O3 — CID 54023820
ethyl 4-methyl-8-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoate (PubChem CID 54023820) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is ethyl 4-methyl-8-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoate.
| Compound Name | ethyl 4-methyl-8-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoate |
|---|---|
| PubChem CID | 54023820 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | ethyl 4-methyl-8-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-3,5,7-trienoate |
| SMILES | CCCOc1cc2c(cc1C=CC=CC(C)=CCC(=O)OCC)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H40O3/c1-8-18-31-25-20-24-23(27(4,5)16-17-28(24,6)7)19-22(25)13-11-10-12-21(3)14-15-26(29)30-9-2/h10-14,19-20H,8-9,15-18H2,1-7H3 |
| InChIKey | LATLBEOPOSSQGP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|