C26H31IO3 — CID 67581750
ethyl 4-[3-[(3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]prop-1-enyl]benzoate (PubChem CID 67581750) has the molecular formula C26H31IO3 and a molecular weight of 518.44 g/mol. Its IUPAC name is ethyl 4-[3-[(3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[3-[(3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 67581750 |
| Molecular Formula | C26H31IO3 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | ethyl 4-[3-[(3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=CCOc2cc3c(cc2I)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C26H31IO3/c1-6-29-24(28)19-11-9-18(10-12-19)8-7-15-30-23-17-21-20(16-22(23)27)25(2,3)13-14-26(21,4)5/h7-12,16-17H,6,13-15H2,1-5H3 |
| InChIKey | DEAIOJFLCKHVSK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|