C26H30O4 — CID 23518603
ethyl 4-[(E)-2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 23518603) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is ethyl 4-[(E)-2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate.
| Compound Name | ethyl 4-[(E)-2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 23518603 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | ethyl 4-[(E)-2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C/c2cc3c(cc2CO)C(C)(C)CC(=O)C3(C)C)cc1 |
| InChI | InChI=1S/C26H30O4/c1-6-30-24(29)18-10-7-17(8-11-18)9-12-19-13-22-21(14-20(19)16-27)25(2,3)15-23(28)26(22,4)5/h7-14,27H,6,15-16H2,1-5H3/b12-9+ |
| InChIKey | FJHLRYQELYSUDV-FMIVXFBMSA-N |
| XLogP | 5.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|