C25H28O4 — CID 74058453
methyl 4-[2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 74058453) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 4-[2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate.
| Compound Name | methyl 4-[2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 74058453 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methyl 4-[2-[3-(hydroxymethyl)-5,5,8,8-tetramethyl-7-oxo-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(C=Cc2cc3c(cc2CO)C(C)(C)CC(=O)C3(C)C)cc1 |
| InChI | InChI=1S/C25H28O4/c1-24(2)14-22(27)25(3,4)21-12-18(19(15-26)13-20(21)24)11-8-16-6-9-17(10-7-16)23(28)29-5/h6-13,26H,14-15H2,1-5H3 |
| InChIKey | GGPGBLOFJTVBKW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|