C27H34O3 — CID 10158272
4-[(E)-2-[3-(4-hydroxybutyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 10158272) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[(E)-2-[3-(4-hydroxybutyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[3-(4-hydroxybutyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 10158272 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-[(E)-2-[3-(4-hydroxybutyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(CCCCO)c(/C=C/c3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C27H34O3/c1-26(2)14-15-27(3,4)24-18-22(21(17-23(24)26)7-5-6-16-28)13-10-19-8-11-20(12-9-19)25(29)30/h8-13,17-18,28H,5-7,14-16H2,1-4H3,(H,29,30)/b13-10+ |
| InChIKey | ZLPXPKHLVLVMFW-JLHYYAGUSA-N |
| XLogP | 6.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|