C22H25NO3 — CID 10360594
1-(4-carboxyphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanimine oxide (PubChem CID 10360594) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(4-carboxyphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanimine oxide.
| Compound Name | 1-(4-carboxyphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanimine oxide |
|---|---|
| PubChem CID | 10360594 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(4-carboxyphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanimine oxide |
| SMILES | CC1(C)CCC(C)(C)c2cc(/[N+]([O-])=C/c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C22H25NO3/c1-21(2)11-12-22(3,4)19-13-17(9-10-18(19)21)23(26)14-15-5-7-16(8-6-15)20(24)25/h5-10,13-14H,11-12H2,1-4H3,(H,24,25)/b23-14- |
| InChIKey | CUSJCCNXEBVKSU-UCQKPKSFSA-N |
| XLogP | 4.99 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|