C27H29NO2S2 — CID 10298461
4-[(E)-2-[5,5,8,8-tetramethyl-3-(1,3-thiazol-2-ylsulfanylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 10298461) has the molecular formula C27H29NO2S2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 4-[(E)-2-[5,5,8,8-tetramethyl-3-(1,3-thiazol-2-ylsulfanylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[5,5,8,8-tetramethyl-3-(1,3-thiazol-2-ylsulfanylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 10298461 |
| Molecular Formula | C27H29NO2S2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[(E)-2-[5,5,8,8-tetramethyl-3-(1,3-thiazol-2-ylsulfanylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(CSc3nccs3)c(/C=C/c3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C27H29NO2S2/c1-26(2)11-12-27(3,4)23-16-21(17-32-25-28-13-14-31-25)20(15-22(23)26)10-7-18-5-8-19(9-6-18)24(29)30/h5-10,13-16H,11-12,17H2,1-4H3,(H,29,30)/b10-7+ |
| InChIKey | IXHYMFJFKJDYMN-JXMROGBWSA-N |
| XLogP | 7.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|