C28H30O2S — CID 10113541
4-[(E)-2-[5,5,8,8-tetramethyl-3-(thiophen-2-ylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 10113541) has the molecular formula C28H30O2S and a molecular weight of 430.61 g/mol. Its IUPAC name is 4-[(E)-2-[5,5,8,8-tetramethyl-3-(thiophen-2-ylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[5,5,8,8-tetramethyl-3-(thiophen-2-ylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 10113541 |
| Molecular Formula | C28H30O2S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-[(E)-2-[5,5,8,8-tetramethyl-3-(thiophen-2-ylmethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(Cc3cccs3)c(/C=C/c3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C28H30O2S/c1-27(2)13-14-28(3,4)25-18-22(16-23-6-5-15-31-23)21(17-24(25)27)12-9-19-7-10-20(11-8-19)26(29)30/h5-12,15,17-18H,13-14,16H2,1-4H3,(H,29,30)/b12-9+ |
| InChIKey | VFVVRLKFQBNMRM-FMIVXFBMSA-N |
| XLogP | 7.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|