C27H31N3O2S — CID 74058409
4-[2-[5,5,8,8-tetramethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 74058409) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is 4-[2-[5,5,8,8-tetramethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[5,5,8,8-tetramethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 74058409 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 4-[2-[5,5,8,8-tetramethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | Cn1cnnc1SCc1cc2c(cc1C=Cc1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H31N3O2S/c1-26(2)12-13-27(3,4)23-15-21(16-33-25-29-28-17-30(25)5)20(14-22(23)26)11-8-18-6-9-19(10-7-18)24(31)32/h6-11,14-15,17H,12-13,16H2,1-5H3,(H,31,32) |
| InChIKey | GBJBXZJARZIEEU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|