C29H39NO2 — CID 69136748
4-[2-[5,5,8,8-tetramethyl-3-[3-(propylamino)propyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 69136748) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 4-[2-[5,5,8,8-tetramethyl-3-[3-(propylamino)propyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[5,5,8,8-tetramethyl-3-[3-(propylamino)propyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 69136748 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 4-[2-[5,5,8,8-tetramethyl-3-[3-(propylamino)propyl]-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CCCNCCCc1cc2c(cc1C=Cc1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H39NO2/c1-6-17-30-18-7-8-23-19-25-26(29(4,5)16-15-28(25,2)3)20-24(23)14-11-21-9-12-22(13-10-21)27(31)32/h9-14,19-20,30H,6-8,15-18H2,1-5H3,(H,31,32) |
| InChIKey | VQOXNPGHDMJQHC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|