C23H26NO3+ — CID 75196259
methyl 1-ethyl-2-[2-(4-methoxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-6-carboxylate (PubChem CID 75196259) has the molecular formula C23H26NO3+ and a molecular weight of 364.47 g/mol. Its IUPAC name is methyl 1-ethyl-2-[2-(4-methoxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-6-carboxylate.
| Compound Name | methyl 1-ethyl-2-[2-(4-methoxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 75196259 |
| Molecular Formula | C23H26NO3+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | methyl 1-ethyl-2-[2-(4-methoxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-6-carboxylate |
| SMILES | CC[N+]1=C(C=Cc2ccc(OC)cc2)C(C)(C)c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C23H26NO3/c1-6-24-20-15-17(22(25)27-5)10-13-19(20)23(2,3)21(24)14-9-16-7-11-18(26-4)12-8-16/h7-15H,6H2,1-5H3/q+1 |
| InChIKey | SDIVNSJBSOMZBB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|