C26H30O3 — CID 23518599
ethyl 4-[(E)-2-(3,5,5,8,8-pentamethyl-6-oxo-7H-naphthalen-2-yl)ethenyl]benzoate (PubChem CID 23518599) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl 4-[(E)-2-(3,5,5,8,8-pentamethyl-6-oxo-7H-naphthalen-2-yl)ethenyl]benzoate.
| Compound Name | ethyl 4-[(E)-2-(3,5,5,8,8-pentamethyl-6-oxo-7H-naphthalen-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 23518599 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | ethyl 4-[(E)-2-(3,5,5,8,8-pentamethyl-6-oxo-7H-naphthalen-2-yl)ethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C/c2cc3c(cc2C)C(C)(C)C(=O)CC3(C)C)cc1 |
| InChI | InChI=1S/C26H30O3/c1-7-29-24(28)19-11-8-18(9-12-19)10-13-20-15-21-22(14-17(20)2)26(5,6)23(27)16-25(21,3)4/h8-15H,7,16H2,1-6H3/b13-10+ |
| InChIKey | KDRVVEVBANGUEG-JLHYYAGUSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|