C25H27BrO3 — CID 23498955
4-[(E)-2-[3-(bromomethyl)-5,5,8,8-tetramethyl-6-oxo-7H-naphthalen-2-yl]ethenyl]-2-methylbenzoic acid (PubChem CID 23498955) has the molecular formula C25H27BrO3 and a molecular weight of 455.39 g/mol. Its IUPAC name is 4-[(E)-2-[3-(bromomethyl)-5,5,8,8-tetramethyl-6-oxo-7H-naphthalen-2-yl]ethenyl]-2-methylbenzoic acid.
| Compound Name | 4-[(E)-2-[3-(bromomethyl)-5,5,8,8-tetramethyl-6-oxo-7H-naphthalen-2-yl]ethenyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 23498955 |
| Molecular Formula | C25H27BrO3 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 4-[(E)-2-[3-(bromomethyl)-5,5,8,8-tetramethyl-6-oxo-7H-naphthalen-2-yl]ethenyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(/C=C/c2cc3c(cc2CBr)C(C)(C)C(=O)CC3(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C25H27BrO3/c1-15-10-16(7-9-19(15)23(28)29)6-8-17-11-20-21(12-18(17)14-26)25(4,5)22(27)13-24(20,2)3/h6-12H,13-14H2,1-5H3,(H,28,29)/b8-6+ |
| InChIKey | GELWEDDUIFWFLB-SOFGYWHQSA-N |
| XLogP | 6.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|