C34H52O3 — CID 173230525
2-ethyl-7-[2-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhepta-2,4-dienoic acid (PubChem CID 173230525) has the molecular formula C34H52O3 and a molecular weight of 508.79 g/mol. Its IUPAC name is 2-ethyl-7-[2-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhepta-2,4-dienoic acid.
| Compound Name | 2-ethyl-7-[2-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173230525 |
| Molecular Formula | C34H52O3 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.39 |
| IUPAC Name | 2-ethyl-7-[2-(3-heptoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhepta-2,4-dienoic acid |
| SMILES | CCCCCCCOc1cc2c(cc1C1CC1CCC=CC(C)=C(CC)C(=O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H52O3/c1-8-10-11-12-15-20-37-31-23-30-29(33(4,5)18-19-34(30,6)7)22-28(31)27-21-25(27)17-14-13-16-24(3)26(9-2)32(35)36/h13,16,22-23,25,27H,8-12,14-15,17-21H2,1-7H3,(H,35,36) |
| InChIKey | WVWACCOPUKRXBX-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|