C25H34O3 — CID 152758159
(2E,4E)-6-[2-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhexa-2,4-dienoic acid (PubChem CID 152758159) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (2E,4E)-6-[2-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-[2-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 152758159 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (2E,4E)-6-[2-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylhexa-2,4-dienoic acid |
| SMILES | COc1cc2c(cc1C1CC1C/C=C/C(C)=C/C(=O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H34O3/c1-16(12-23(26)27)8-7-9-17-13-18(17)19-14-20-21(15-22(19)28-6)25(4,5)11-10-24(20,2)3/h7-8,12,14-15,17-18H,9-11,13H2,1-6H3,(H,26,27)/b8-7+,16-12+ |
| InChIKey | MNBBWWOYJOMINU-PXARDFSYSA-N |
| XLogP | 6.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|