C23H33NO2 — CID 164708300
(2E,4E)-3-methyl-6-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]hexa-2,4-dienoic acid (PubChem CID 164708300) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (2E,4E)-3-methyl-6-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-methyl-6-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 164708300 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2E,4E)-3-methyl-6-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]hexa-2,4-dienoic acid |
| SMILES | CC(/C=C/CN(C)c1cc2c(cc1C)C(C)(C)CCC2(C)C)=C\C(=O)O |
| InChI | InChI=1S/C23H33NO2/c1-16(13-21(25)26)9-8-12-24(7)20-15-19-18(14-17(20)2)22(3,4)10-11-23(19,5)6/h8-9,13-15H,10-12H2,1-7H3,(H,25,26)/b9-8+,16-13+ |
| InChIKey | BIVGSWBKTSKGKE-RTIVBGQYSA-N |
| XLogP | 5.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|