C28H40O3 — CID 152758160
(2E,4E)-3-methyl-6-[2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)cyclopropyl]hepta-2,4-dienoic acid (PubChem CID 152758160) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is (2E,4E)-3-methyl-6-[2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)cyclopropyl]hepta-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-methyl-6-[2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)cyclopropyl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 152758160 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (2E,4E)-3-methyl-6-[2-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)cyclopropyl]hepta-2,4-dienoic acid |
| SMILES | CCCOc1cc2c(cc1C1CC1C(C)/C=C/C(C)=C/C(=O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H40O3/c1-8-13-31-25-17-24-23(27(4,5)11-12-28(24,6)7)16-22(25)21-15-20(21)19(3)10-9-18(2)14-26(29)30/h9-10,14,16-17,19-21H,8,11-13,15H2,1-7H3,(H,29,30)/b10-9+,18-14+ |
| InChIKey | XHNRBNKZUQNSNR-BFHPBESDSA-N |
| XLogP | 7.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|