C27H38F2O3 — CID 142926440
(2Z,4E,6E)-2,6-difluoro-3-methyl-7-(5,5,8-trimethyl-3-propoxy-7,8-dihydro-6H-naphthalen-2-yl)octa-2,4,6-trienoic acid;ethane (PubChem CID 142926440) has the molecular formula C27H38F2O3 and a molecular weight of 448.59 g/mol. Its IUPAC name is (2Z,4E,6E)-2,6-difluoro-3-methyl-7-(5,5,8-trimethyl-3-propoxy-7,8-dihydro-6H-naphthalen-2-yl)octa-2,4,6-trienoic acid;ethane.
| Compound Name | (2Z,4E,6E)-2,6-difluoro-3-methyl-7-(5,5,8-trimethyl-3-propoxy-7,8-dihydro-6H-naphthalen-2-yl)octa-2,4,6-trienoic acid;ethane |
|---|---|
| PubChem CID | 142926440 |
| Molecular Formula | C27H38F2O3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (2Z,4E,6E)-2,6-difluoro-3-methyl-7-(5,5,8-trimethyl-3-propoxy-7,8-dihydro-6H-naphthalen-2-yl)octa-2,4,6-trienoic acid;ethane |
| SMILES | CC.CCCOc1cc2c(cc1/C(C)=C(F)\C=C\C(C)=C(/F)C(=O)O)C(C)CCC2(C)C |
| InChI | InChI=1S/C25H32F2O3.C2H6/c1-7-12-30-22-14-20-18(15(2)10-11-25(20,5)6)13-19(22)17(4)21(26)9-8-16(3)23(27)24(28)29;1-2/h8-9,13-15H,7,10-12H2,1-6H3,(H,28,29);1-2H3/b9-8+,21-17+,23-16-; |
| InChIKey | FOZRWQMIIJQTPI-LWIDOBOESA-N |
| XLogP | 8.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|