C18H33N — CID 142087332
ethane;propane;5,8,8-trimethyl-6,7-dihydro-5H-naphthalen-2-amine (PubChem CID 142087332) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is ethane;propane;5,8,8-trimethyl-6,7-dihydro-5H-naphthalen-2-amine.
| Compound Name | ethane;propane;5,8,8-trimethyl-6,7-dihydro-5H-naphthalen-2-amine |
|---|---|
| PubChem CID | 142087332 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | ethane;propane;5,8,8-trimethyl-6,7-dihydro-5H-naphthalen-2-amine |
| SMILES | CC.CC1CCC(C)(C)c2cc(N)ccc21.CCC |
| InChI | InChI=1S/C13H19N.C3H8.C2H6/c1-9-6-7-13(2,3)12-8-10(14)4-5-11(9)12;1-3-2;1-2/h4-5,8-9H,6-7,14H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | LPGXNFFIIWRCNA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|