C23H30N2 — CID 153378822
5,5,5',5'-tetramethyl-8,8'-spirobi[6,7-dihydronaphthalene]-2,2'-diamine (PubChem CID 153378822) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 5,5,5',5'-tetramethyl-8,8'-spirobi[6,7-dihydronaphthalene]-2,2'-diamine.
| Compound Name | 5,5,5',5'-tetramethyl-8,8'-spirobi[6,7-dihydronaphthalene]-2,2'-diamine |
|---|---|
| PubChem CID | 153378822 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 5,5,5',5'-tetramethyl-8,8'-spirobi[6,7-dihydronaphthalene]-2,2'-diamine |
| SMILES | CC1(C)CCC2(CCC(C)(C)c3ccc(N)cc32)c2cc(N)ccc21 |
| InChI | InChI=1S/C23H30N2/c1-21(2)9-11-23(19-13-15(24)5-7-17(19)21)12-10-22(3,4)18-8-6-16(25)14-20(18)23/h5-8,13-14H,9-12,24-25H2,1-4H3 |
| InChIKey | TXNFWRIBBSOMLI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|