C18H20N2 — CID 102196246
1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-4,12-diamine (PubChem CID 102196246) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-4,12-diamine.
| Compound Name | 1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-4,12-diamine |
|---|---|
| PubChem CID | 102196246 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-4,12-diamine |
| SMILES | CC12CCC(C)(c3cc(N)ccc31)c1cc(N)ccc12 |
| InChI | InChI=1S/C18H20N2/c1-17-7-8-18(2,15-9-11(19)3-5-13(15)17)16-10-12(20)4-6-14(16)17/h3-6,9-10H,7-8,19-20H2,1-2H3 |
| InChIKey | RMCUHGUKEJSKGW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|