C39H58O3S2 — CID 139626406
1,3-bis(7-heptoxy-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)propan-2-one (PubChem CID 139626406) has the molecular formula C39H58O3S2 and a molecular weight of 639.02 g/mol. Its IUPAC name is 1,3-bis(7-heptoxy-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)propan-2-one.
| Compound Name | 1,3-bis(7-heptoxy-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)propan-2-one |
|---|---|
| PubChem CID | 139626406 |
| Molecular Formula | C39H58O3S2 |
| Molecular Weight | 639.02 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | 1,3-bis(7-heptoxy-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)propan-2-one |
| SMILES | CCCCCCCOc1cc2c(cc1CC(=O)Cc1cc3c(cc1OCCCCCCC)SCCC3(C)C)C(C)(C)CCS2 |
| InChI | InChI=1S/C39H58O3S2/c1-7-9-11-13-15-19-41-34-27-36-32(38(3,4)17-21-43-36)25-29(34)23-31(40)24-30-26-33-37(44-22-18-39(33,5)6)28-35(30)42-20-16-14-12-10-8-2/h25-28H,7-24H2,1-6H3 |
| InChIKey | WPUNTRILNXXKGM-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.02 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|