C18H28O4 — CID 66696465
[(Z,2R)-5-butoxy-5-hydroxypent-3-en-2-yl] (E)-3-(cyclohexen-1-yl)prop-2-enoate (PubChem CID 66696465) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(Z,2R)-5-butoxy-5-hydroxypent-3-en-2-yl] (E)-3-(cyclohexen-1-yl)prop-2-enoate.
| Compound Name | [(Z,2R)-5-butoxy-5-hydroxypent-3-en-2-yl] (E)-3-(cyclohexen-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 66696465 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(Z,2R)-5-butoxy-5-hydroxypent-3-en-2-yl] (E)-3-(cyclohexen-1-yl)prop-2-enoate |
| SMILES | CCCCOC(O)/C=C\[C@@H](C)OC(=O)/C=C/C1=CCCCC1 |
| InChI | InChI=1S/C18H28O4/c1-3-4-14-21-17(19)12-10-15(2)22-18(20)13-11-16-8-6-5-7-9-16/h8,10-13,15,17,19H,3-7,9,14H2,1-2H3/b12-10-,13-11+/t15-,17?/m1/s1 |
| InChIKey | WBCSYKZECBNYSR-YIFGCGBLSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|